| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 5-Bromo-2-fluorotoluene Basic information |
| | 5-Bromo-2-fluorotoluene Chemical Properties |
| Boiling point | 94-95 °C (50 mmHg) | | density | 1.486 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.529(lit.) | | Fp | 165 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Liquid | | Specific Gravity | 1.486 | | color | Clear colorless | | Water Solubility | INSOLUBLE | | BRN | 2242693 | | InChI | InChI=1S/C7H6BrF/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 | | InChIKey | VXKYOKPNAXNAFU-UHFFFAOYSA-N | | SMILES | C1(F)=CC=C(Br)C=C1C | | CAS DataBase Reference | 51437-00-4(CAS DataBase Reference) | | NIST Chemistry Reference | 5-Bromo-2-fluorotoluene(51437-00-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29036990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5-Bromo-2-fluorotoluene Usage And Synthesis |
| Chemical Properties | colorless to light yellow liqui | | Uses | 5-Bromo-2-fluorotoluene is used in the preparation of 5-bromo-2-fluorobenzyl bromide via N-bromosuccinimide (NBS) bromination, required for the synthesis of crown bromofluorobenzene and 3-(4-fuoro-3-methylphenyl)acrylamide. It is also used as an intermediates of medicine. | | Uses | 5-Bromo-2-fluorotoluene has been used in the preparation of:
- 5-bromo-2-fluorobenzyl bromide via N-bromosuccinimide (NBS) bromination, required for the synthesis of crown bromofluorobenzene
- 3-(4-fuoro-3-methylphenyl)acrylamide
|
| | 5-Bromo-2-fluorotoluene Preparation Products And Raw materials |
|