| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Cyclopentadienylzirconium trichloride Basic information |
| | Cyclopentadienylzirconium trichloride Chemical Properties |
| Melting point | 210 °C (dec.)(lit.) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Powder | | color | off-white to tan | | Water Solubility | reacts | | Sensitive | Moisture Sensitive | | InChI | 1S/C5H5.3ClH.Zr/c1-2-4-5-3-1;;;;/h1-5H;3*1H;/q;;;;+3/p-3 | | InChIKey | SULDCQJIUCVYOB-UHFFFAOYSA-K | | SMILES | Cl[Zr](Cl)Cl.[CH]1[CH][CH][CH][CH]1 | | CAS DataBase Reference | 34767-44-7(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34-29-20/21/22 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29319090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | Cyclopentadienylzirconium trichloride Usage And Synthesis |
| Chemical Properties |
white to light brown powder. Insoluble in most noncoordinating solvents; however, it becomes soluble in benzene or chloroform in the presence of two equiv of donor agents such as ether, THF, triethylamine, or pyridine.
| | Uses | Catalyst for:
- Homo- and copolymerization reactions
- Catalytic dehydrogenation of cyclooctane
- Cross-coupling reaction of aryl fluorides with a phenethyl Grignard reagents
| | reaction suitability | core: zirconium
reagent type: catalyst | | Synthesis | Trichloro(cyclopentadienyl)zirconium is prepared by the photoinduced chlorination of Dichlorobis(cyclopentadienyl)zirconium.
|
| | Cyclopentadienylzirconium trichloride Preparation Products And Raw materials |
|