|
|
| | 5-Hydroxy-2-mercapto-benzimidazole Basic information |
| | 5-Hydroxy-2-mercapto-benzimidazole Chemical Properties |
| Melting point | 287-290 °C(Solv: acetone (67-64-1)) | | Boiling point | 349.8±44.0 °C(Predicted) | | density | 1.57±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 9.97±0.20(Predicted) | | color | Light Yellow to Brown | | InChI | InChI=1S/C7H6N2OS/c10-4-1-2-5-6(3-4)9-7(11)8-5/h1-3,10H,(H2,8,9,11) | | InChIKey | DFKVVBOVTVBURY-UHFFFAOYSA-N | | SMILES | C1(=S)NC2=CC=C(O)C=C2N1 |
| | 5-Hydroxy-2-mercapto-benzimidazole Usage And Synthesis |
| Chemical Properties | Yellow to Brown Solid | | Uses | A metabolite of leminoprazole, a new proton pump inhibitor with potent cytoprotective effect on the gastric mucosa |
| | 5-Hydroxy-2-mercapto-benzimidazole Preparation Products And Raw materials |
|