Azelaprag manufacturers
- Azelaprag
-
- $107.00
-
2026-07-31
- CAS:2049980-18-7
- Purity: 98.04%
- Supply Ability: 10g
- Azelaprag
-
- $107.00
-
2026-07-31
- CAS:2049980-18-7
- Purity: 98.04%
- Supply Ability: 10g
|
| | Azelaprag Basic information |
| Product Name: | Azelaprag | | Synonyms: | Azelaprag;2-Pyrimidineethanesulfonamide, N-[4-(2,6-dimethoxyphenyl)-5-(5-methyl-3-pyridinyl)-4H-1,2,4-triazol-3-yl]-α,β,5-trimethyl-, (αS,βR)-;Azelaprag (AMG 986);(2S,3R)-N-(4-(2,6-Dimethoxyphenyl)-5-(5-methylpyridin-3-yl)-4H-1,2,4-triazol-3-yl)-3-(5-methylpyrimidin-2-yl)butane-2-sulfonamide;AMG 986;BGE-105 | | CAS: | 2049980-18-7 | | MF: | C25H29N7O4S | | MW: | 523.61 | | EINECS: | | | Product Categories: | | | Mol File: | 2049980-18-7.mol |  |
| | Azelaprag Chemical Properties |
| Boiling point | 738.0±70.0 °C(Predicted) | | density | 1.35±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | Soluble in DMSO | | form | Solid | | pka | 4.43±0.10(Predicted) | | color | White to light yellow | | InChIKey | DOMQFIFVDIAOOT-HCAOVKSPNA-N | | SMILES | N(C1=NN=C(C2=CN=CC(C)=C2)N1C1C(=CC=CC=1OC)OC)S(=O)(=O)[C@@H](C)[C@@H](C1=NC=C(C)C=N1)C |&1:26,28,r| |
| | Azelaprag Usage And Synthesis |
| Uses | Azelaprag (Example 263.0) is a candidate active molecule for an Apelin receptor agonist with an EC50 of 0.32 nM for the apelin receptor[1]. | | References | [1] WO2016187308A1.
[2] Ason B, et.al. Cardiovascular response to small-molecule APJ activation. JCI Insight. 2020 Apr 23;5(8):e132898. DOI:10.1172/jci.insight.132898 |
| | Azelaprag Preparation Products And Raw materials |
|