- HM-cytosine
-
- $91.00
-
2026-04-22
- CAS:1123-95-1
- Purity: 99.89%
- Supply Ability: 10g
|
| | 5-Hydroxymethylcytosine Basic information |
| Product Name: | 5-Hydroxymethylcytosine | | Synonyms: | 4-AMINO-2-HYDROXY-5-HYDROXYMETHYLPYRIMIDINE;5-(Hydroxymethyl)Cytosine Hydrochloride;5-Hydroxymethylcytosinefreebase;2(1H)-Pyrimidinone, 4-amino-5-(hydroxymethyl)- (9CI);4-AMINO-5-(HYDROXYMETHYL)PYRIMIDIN-2-OL;4-Amino-5-(hydroxymethyl)pyrimidin-2-ol ,97%;4-Amino-5-(hydroxymethyl)-2(1H)-pyrimidinone;4-Amino-5-hydroxymethyl-2(1H)-pyrimidinone | | CAS: | 1123-95-1 | | MF: | C5H7N3O2 | | MW: | 141.13 | | EINECS: | | | Product Categories: | Nucleic acids;PYRIMIDINE;Elisa Kit-Rat Elisa Kit | | Mol File: | 1123-95-1.mol |  |
| | 5-Hydroxymethylcytosine Chemical Properties |
| Melting point | >299.85°C | | Boiling point | 258.15°C (rough estimate) | | density | 1.3818 (rough estimate) | | refractive index | 1.6190 (estimate) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | DMSO (Sparingly), Methanol (Slightly, Heated, Sonicated) | | form | Solid | | pka | 8.61±0.10(Predicted) | | color | Pale Yellow to Beige | | Major Application | cell analysis clinical research general analytical life science and biopharma metabolomics | | InChI | InChI=1S/C5H7N3O2/c6-4-3(2-9)1-7-5(10)8-4/h1,9H,2H2,(H3,6,7,8,10) | | InChIKey | RYVNIFSIEDRLSJ-UHFFFAOYSA-N | | SMILES | OCC1=CNC(N=C1N)=O |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29335990 | | Storage Class | 11 - Combustible Solids |
| | 5-Hydroxymethylcytosine Usage And Synthesis |
| Chemical Properties | Grey solid | | Uses | 5-(Hydroxymethyl)cytosine is a DNA pyrimidine nitrogen base.It may regulate gene expression or prompt DNA demethylation. 5-Hydroxymethylcytosine may be especially important in the central nervous system, as it is found in very high levels there. | | Definition | ChEBI: A nucleobase analogue that is cytosine in which the hydrogen at position 5 is replaced by a hydroxymethyl group. |
| | 5-Hydroxymethylcytosine Preparation Products And Raw materials |
|