| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-(Trifluoromethyl)benzyl alcohol Basic information |
| | 4-(Trifluoromethyl)benzyl alcohol Chemical Properties |
| Melting point | 22-25 °C | | Boiling point | 78-80 °C/4 mmHg (lit.) | | density | 1.286 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.459(lit.) | | Fp | 213 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Liquid After Melting | | pka | 13.91±0.10(Predicted) | | Specific Gravity | 1.286 | | color | Clear colorless to light brown | | Water Solubility | Soluble in water. | | BRN | 1450174 | | InChI | InChI=1S/C8H7F3O/c9-8(10,11)7-3-1-6(5-12)2-4-7/h1-4,12H,5H2 | | InChIKey | MOOUWXDQAUXZRG-UHFFFAOYSA-N | | SMILES | C1(CO)=CC=C(C(F)(F)F)C=C1 | | CAS DataBase Reference | 349-95-1(CAS DataBase Reference) | | NIST Chemistry Reference | 4-(Trifluoromethyl)benzyl alcohol(349-95-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | F | 10-23 | | Hazard Note | Irritant | | HazardClass | CORROSIVE | | HS Code | 29062900 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-(Trifluoromethyl)benzyl alcohol Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liqui | | Uses | 4-(Trifluoromethyl)benzyl alcohol, is used as a pharmaceutical intermediate, it is also used to predict the NMR spectrum. 4-(Trifluoromethyl)benzyl alcohol is employed as a reagent in, for example, kinetic studies of phosphonoformate prodrugs and aquachromium(IV). | | Definition | ChEBI: 4-(trifluoromethyl)benzyl alcohol is an aromatic primary alcohol. It is functionally related to a benzyl alcohol. | | Synthesis Reference(s) | Tetrahedron Letters, 29, p. 4057, 1988 DOI: 10.1016/S0040-4039(00)80416-5 | | General Description | Photocatalytic oxidation of 4-(trifluoromethyl)benzyl alcohol to corresponding aldehydes on TiO2 photocatalyst under O2 atmosphere has been reported. |
| | 4-(Trifluoromethyl)benzyl alcohol Preparation Products And Raw materials |
|