Brexpiprazole Impurity 34 manufacturers
|
| | Brexpiprazole Impurity 34 Basic information |
| Product Name: | Brexpiprazole Impurity 34 | | Synonyms: | 2(1H)-Quinolinone, 7-[4-(4-benzo[b]thien-4-yl-1,4-dioxido-1-piperazinyl)butoxy]-;Epipiprazole861;Impurities of Epipiprazole2;Brexpiprazole Impurity 21Q: What is
Brexpiprazole Impurity 21 Q: What is the CAS Number of
Brexpiprazole Impurity 21;4-(benzo[b]thiophen-4-yl)-1-(4-((2-oxo-1,2-dihydroquinolin-7-yl)oxy)butyl)piperazine 1-oxide? (Brexpiprazole Impurity);Brexpiprazole Di-N-Oxide
1-(Benzo[b]thiophen-4-yl)-4-(4-((2-oxo-l,2-dihydroquinolin-7- yl)oxy)butyl) piperazine 1,4-dioxide;Brexpiprazole Impurity 34;Brexpiprazole Dimer Impurity H | | CAS: | 2247155-42-4 | | MF: | C25H27N3O4S | | MW: | 465.56 | | EINECS: | | | Product Categories: | | | Mol File: | 2247155-42-4.mol |  |
| | Brexpiprazole Impurity 34 Chemical Properties |
| pka | 11.21±0.70(Predicted) | | InChIKey | UFAZRHMCTHWTFW-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC(OCCCC[N+]3([O-])CC[N+]([O-])(C4=C5C=CSC5=CC=C4)CC3)=C2)C=CC1=O |
| | Brexpiprazole Impurity 34 Usage And Synthesis |
| | Brexpiprazole Impurity 34 Preparation Products And Raw materials |
|