4'-HYDROXY ATOMOXETINE manufacturers
|
| | 4'-HYDROXY ATOMOXETINE Basic information |
| | 4'-HYDROXY ATOMOXETINE Chemical Properties |
| Melting point | 120-122°C | | Boiling point | 438.0±45.0 °C(Predicted) | | density | 1.094±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 10.33±0.20(Predicted) | | color | Off-White to Light Brown | | InChI | InChI=1S/C17H21NO2/c1-13-12-15(19)8-9-16(13)20-17(10-11-18-2)14-6-4-3-5-7-14/h3-9,12,17-19H,10-11H2,1-2H3/t17-/m1/s1 | | InChIKey | PPXQPRLGNSJNJM-QGZVFWFLSA-N | | SMILES | C1(O)=CC=C(O[C@@H](C2=CC=CC=C2)CCNC)C(C)=C1 |
| | 4'-HYDROXY ATOMOXETINE Usage And Synthesis |
| Chemical Properties | Off-White to Light Brown | | Uses | A metabolite of Atomoxetine, a Norepinephrine uptake blocker. | | Definition | ChEBI: 4-Hydroxyatomoxetine is an aromatic ether and a member of phenols. |
| | 4'-HYDROXY ATOMOXETINE Preparation Products And Raw materials |
|