L-(+)-CAMPHORSULFONIC ACID manufacturers
|
| | L-(+)-CAMPHORSULFONIC ACID Basic information |
| Product Name: | L-(+)-CAMPHORSULFONIC ACID | | Synonyms: | (7,7-Dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;DL-(+/-)-Camphorsulfonic;(2-Bromo-5-methoxy-25-methyl-phenyl)-methano | | CAS: | 61380-66-3 | | MF: | C10H16O4S | | MW: | 232.3 | | EINECS: | | | Product Categories: | | | Mol File: | 61380-66-3.mol |  |
| | L-(+)-CAMPHORSULFONIC ACID Chemical Properties |
| InChI | InChI=1S/C10H16O4S/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h7H,3-6H2,1-2H3,(H,12,13,14) | | InChIKey | MIOPJNTWMNEORI-UHFFFAOYSA-N | | SMILES | C(S(O)(=O)=O)C12C(C)(C)C(CC1)CC2=O |
| | L-(+)-CAMPHORSULFONIC ACID Usage And Synthesis |
| Definition | ChEBI: Camphorsulfonic acid is a sulfonic acid containing the camphorsulfonate anion. It is functionally related to a camphor. It is a conjugate acid of a camphorsulfonate anion. |
| | L-(+)-CAMPHORSULFONIC ACID Preparation Products And Raw materials |
|