| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Pomalidomide-C6-PEG1-C3-PEG1-butyl iodide
CAS:1835705-76-4
Purity:Pomalidomide-C6-PEG1-C3-PEG1-butyl iodide Package:50MG Remarks:906050-50MG
|
| Company Name: |
ShangHai Biochempartner Co.,Ltd
|
| Tel: |
177-54423994 17754423994 |
| Email: |
2853530910@QQ.com |
| Products Intro: |
Product Name:Pomalidomide-C6-PEG1-C3-PEG1-butyl iodide
CAS:1835705-76-4
Purity:98% HPLC LCMS Package:100MG;1G
|
| Company Name: |
Xi'an Confluore Biological Technology Co., Ltd.
|
| Tel: |
+86-156-80926068 +86-15680926068 |
| Email: |
1924344760@qq.com |
| Products Intro: |
Product Name:Pomalidomide-6-5-6-I
CAS:1835705-76-4
Purity:95% HPLC Package:10MG;25MG;50MG;100MG;1G;5G
|
Pomalidomide-C6-PEG1-C3-PEG1-butyl iodide manufacturers
- Pomalidomide-6-5-6-I
-
-
2025-06-07
- CAS:1835705-76-4
- Min. Order: 100mg
- Purity: >95.00%
- Supply Ability: 100mg
|
| | Pomalidomide-C6-PEG1-C3-PEG1-butyl iodide Basic information |
| Product Name: | Pomalidomide-C6-PEG1-C3-PEG1-butyl iodide | | Synonyms: | Pomalidomide-C6-PEG1-C3-PEG1-butyl iodide;Hexanamide, N-[2-(2,6-dioxo-3-piperidinyl)-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]-6-[[5-[(6-iodohexyl)oxy]pentyl]oxy]-;Pomalidomide-6-5-6-I;Crosslinker?E3 Ligase ligand conjugate, Pomalidomide-6-5-6-I, N-(2-(2,6-Dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)-6-((5-((6-iodohexyl)oxy)pentyl)oxy)hexanamide, Protein degrader building block for PROTAC? research, Template for synthesis of targeted protein degrader;Pomalidomide-C?-PEG?-C?-PEG?-butyl iodide;N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl]-6-({5-[(6-iodohexyl)oxy]pentyl}oxy)hexanamide;Pomalidomide-C6-PEG1-C3-PEG1-butyl iodide | | CAS: | 1835705-76-4 | | MF: | C30H42IN3O7 | | MW: | 683.57 | | EINECS: | | | Product Categories: | | | Mol File: | 1835705-76-4.mol |  |
| | Pomalidomide-C6-PEG1-C3-PEG1-butyl iodide Chemical Properties |
| Boiling point | 809.7±65.0 °C(Predicted) | | density | 1.412±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 10.69±0.40(Predicted) | | form | powder or crystals | | InChIKey | ABEUETLCTXKUSX-UHFFFAOYSA-N | | SMILES | ICCCCCCOCCCCCOCCCCCC(NC1=CC=CC2=C1C(N(C3CCC(NC3=O)=O)C2=O)=O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Pomalidomide-C6-PEG1-C3-PEG1-butyl iodide Usage And Synthesis |
| Uses | Protein degrader builiding block Pomalidomide-C6-PEG1-C3-PEG1-Butyl Iodide enables the synthesis of molecules for targeted protein degradation and PROTAC (proteolysis-targeting chimeras) technology. This conjugate contains a Cereblon (CRBN)-recruiting ligand, a linker with both hydrophobic and hydrophilic moieties, and a pendant iodoalkane for reactivity with a nucleophilic group on a target ligand. Because even slight alterations in ligands and crosslinkers can affect ternary complex formation between the target, E3 ligase, and PROTAC, many analogs are prepared to screen for optimal target degradation. When used with other protein degrader building blocks with a pendant iodo group, parallel synthesis can be used to more quickly generate PROTAC libraries that feature variation in crosslinker length, composition, and E3 ligase ligand. | | reaction suitability | reactivity: sulfuryl reactive
reagent type: ligand-linker conjugate |
| | Pomalidomide-C6-PEG1-C3-PEG1-butyl iodide Preparation Products And Raw materials |
|