| Company Name: |
TOSUN PHARM |
| Tel: |
020-66392521-118 18922260391 |
| Email: |
3004261881@qq.com |
|
| | Vitamin K1 Impurity 1 Basic information |
| Product Name: | Vitamin K1 Impurity 1 | | Synonyms: | Vitamin K1 Impurity 1;2H-Naphtho[1,2-b]pyran-6-ol, 2,5-dimethyl-2-(4,8,12-trimethyltridecyl)-;Phyllochromenol;Vitamin K1 Impurity 77;2,5-Dimethyl-2-(4,8,12-trimethyltridecyl)-2H-benzo[h]chromen-6-olQ: What is
2,5-Dimethyl-2-(4,8,12-trimethyltridecyl)-2H-benzo[h]chromen-6-ol Q: What is the CAS Number of
2,5-Dimethyl-2-(4,8,12-trimethyltridecyl)-2H-benzo[h]chromen-6-ol;Vitamin K1 (Phytonadione) Impurity 1;Phytonadione Impurity 40;Rac-Vitamin K1 Impurity 1 | | CAS: | 19274-66-9 | | MF: | C31H46O2 | | MW: | 450.7 | | EINECS: | | | Product Categories: | | | Mol File: | 19274-66-9.mol |  |
| | Vitamin K1 Impurity 1 Chemical Properties |
| Boiling point | 574.2±50.0 °C(Predicted) | | density | 0.984±0.06 g/cm3(Predicted) | | storage temp. | Amber Vial, -86°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | pka | 10.24±0.40(Predicted) | | color | Orange to Very Dark Orange | | InChI | InChI=1S/C31H46O2/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-20-31(6)21-19-26-25(5)29(32)27-17-7-8-18-28(27)30(26)33-31/h7-8,17-19,21-24,32H,9-16,20H2,1-6H3 | | InChIKey | IXEMAIWRPCYZEQ-UHFFFAOYSA-N | | SMILES | C12=C3C(C=CC=C3)=C(O)C(C)=C1C=CC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2 |
| | Vitamin K1 Impurity 1 Usage And Synthesis |
| Uses | Phyllochromenol is a metabolite of vitamin K1 |
| | Vitamin K1 Impurity 1 Preparation Products And Raw materials |
|