|
|
| | 2,4,6-TRICHLORO-5-NITROPYRIMIDINE Basic information |
| Product Name: | 2,4,6-TRICHLORO-5-NITROPYRIMIDINE | | Synonyms: | 2,4,6-TRICHLORO-5-NITROPYRIMIDINE;2,4,6-Trichloro-5-nitropyrimidine ,90%;2,4,6-Trichloro-5-nitropyrimidine, tech.;2,4,6-Trichloro-5-nitropyrimidine≥ 97% (HPLC);2,4,6-trichloro-5-nitro-pyriMidine 85+%;Pyrimidine, 2,4,6-trichloro-5-nitro-;2,4,6-Trichloro-5-nitro-pyrimidine, 95+%;2,4,6-TRICHLORO-5-NITROPYRIMDINE | | CAS: | 4359-87-9 | | MF: | C4Cl3N3O2 | | MW: | 228.42 | | EINECS: | 200-001-2 | | Product Categories: | pyrimidine;Heterocycle-Pyrimidine series | | Mol File: | 4359-87-9.mol |  |
| | 2,4,6-TRICHLORO-5-NITROPYRIMIDINE Chemical Properties |
| Melting point | 56-58℃ | | Boiling point | 314℃ | | density | 1.848 | | Fp | 143℃ | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | -10.32±0.39(Predicted) | | form | solid | | color | white | | InChI | InChI=1S/C4Cl3N3O2/c5-2-1(10(11)12)3(6)9-4(7)8-2 | | InChIKey | QGFWFWSBFMRDNP-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC(Cl)=C([N+]([O-])=O)C(Cl)=N1 |
| HazardClass | IRRITANT | | HS Code | 2933399990 |
| | 2,4,6-TRICHLORO-5-NITROPYRIMIDINE Usage And Synthesis |
| Chemical Properties | Off-white to pale yellow solid |
| | 2,4,6-TRICHLORO-5-NITROPYRIMIDINE Preparation Products And Raw materials |
|