| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-BROMO-3-CHLORO-5-NITROBENZENE Basic information |
| | 1-BROMO-3-CHLORO-5-NITROBENZENE Chemical Properties |
| Melting point | 81.2 °C | | Boiling point | 268.8±20.0 °C(Predicted) | | density | 1.827±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | color | White to yellow | | InChI | InChI=1S/C6H3BrClNO2/c7-4-1-5(8)3-6(2-4)9(10)11/h1-3H | | InChIKey | CVXDZAQINLBEIC-UHFFFAOYSA-N | | SMILES | C1(Br)=CC([N+]([O-])=O)=CC(Cl)=C1 |
| | 1-BROMO-3-CHLORO-5-NITROBENZENE Usage And Synthesis |
| | 1-BROMO-3-CHLORO-5-NITROBENZENE Preparation Products And Raw materials |
|