|
|
| | Adenine hydrochloride hemihydrate Basic information |
| Product Name: | Adenine hydrochloride hemihydrate | | Synonyms: | Adenine Purine hydrochloride;7H-Purin-6-amine hydrochloride hydrate;9H-purin-6-amine dihydrochloride hydrate;Adenine monohydrochloride hemihydrate;ADENINE HYDROCHLORIDE HEMIHYDRATE;ADENINE HYDROCHLORIDE CELL CULTURE TESTED;ADENINE HYDROCHLORIDE (For Biochemistry);AdenineHClhemihydrate | | CAS: | 6055-72-7 | | MF: | C5H8ClN5O | | MW: | 189.6 | | EINECS: | | | Product Categories: | Nucleic acids | | Mol File: | 6055-72-7.mol |  |
| | Adenine hydrochloride hemihydrate Chemical Properties |
| Melting point | 289-291°C (dec.) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | H2O: 50 mg/mL | | form | powder | | color | White to Almost white | | InChI | InChI=1S/C5H5N5.ClH.H2O/c6-4-3-5(9-1-7-3)10-2-8-4;;/h1-2H,(H3,6,7,8,9,10);1H;1H2 | | InChIKey | MYRDTAUFFBYTHA-UHFFFAOYSA-N | | SMILES | NC1NC=NC2=NC=NC=12.Cl.O |
| Risk Statements | 22 | | Safety Statements | 36 | | WGK Germany | 3 | | HS Code | 29349990 |
| Provider | Language |
|
ALFA
| English |
| | Adenine hydrochloride hemihydrate Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Widespread throughout animal and plant tissues combined with niacinamide, d-ribose, and phosphoric acids; a constituent of nucleic acids and coenzymes, such as codehydrase I and II, adenylic acid, coalaninedehydrase. It is used in microbial determination of niacin; in research on heredity, virus diseases, and cancer. |
| | Adenine hydrochloride hemihydrate Preparation Products And Raw materials |
|