| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Bis(3,5-di(trifluoromethyl)phenyl)phosphine Basic information |
| | Bis(3,5-di(trifluoromethyl)phenyl)phosphine Chemical Properties |
| Melting point | 69-73 °C | | Boiling point | 297.9±40.0 °C(Predicted) | | form | solid | | InChI | 1S/C16H7F12P/c17-13(18,19)7-1-8(14(20,21)22)4-11(3-7)29-12-5-9(15(23,24)25)2-10(6-12)16(26,27)28/h1-6,29H | | InChIKey | OTQIBIWGQUJMOM-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1cc(Pc2cc(cc(c2)C(F)(F)F)C(F)(F)F)cc(c1)C(F)(F)F |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | RIDADR | UN 3335 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Bis(3,5-di(trifluoromethyl)phenyl)phosphine Usage And Synthesis |
| reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst reagent type: ligand |
| | Bis(3,5-di(trifluoromethyl)phenyl)phosphine Preparation Products And Raw materials |
|