Tris[3,5-bis(trifluoromethyl)phenyl]phosphine manufacturers
|
| | Tris[3,5-bis(trifluoromethyl)phenyl]phosphine Basic information |
| Product Name: | Tris[3,5-bis(trifluoromethyl)phenyl]phosphine | | Synonyms: | Tris[3,5-Bis(Trifluorome;Tris[3,5-bis(trifluoromethyl)phenyl]phosphane;Tris(3,5-bis(trifluoromethyl);TRI[3,5-DI(TRIFLUOROMETHYL)PHENYL]PHOSPHINE;TRIS[3,5-DI(TRIFLUOROMETHYL)PHENYL]PHOSPHINE;TRIS[BIS(3,5-TRIFLUOROMETHYL)PHENYL]PHOSPHINE;TRIS[3,5-BIS(TRIFLUOROMETHYL)PHENYL]PHOSPHINE 97%;Tris3,5-bis(trifluoromethyl)phenylüphosphine, 94% | | CAS: | 175136-62-6 | | MF: | C24H9F18P | | MW: | 670.27 | | EINECS: | | | Product Categories: | Achiral Phosphine;Aryl Phosphine;Catalysis and Inorganic Chemistry;Phosphine Ligands;Phosphorus Compounds | | Mol File: | 175136-62-6.mol | ![Tris[3,5-bis(trifluoromethyl)phenyl]phosphine Structure](CAS/GIF/175136-62-6.gif) |
| | Tris[3,5-bis(trifluoromethyl)phenyl]phosphine Chemical Properties |
| Melting point | 95 °C | | Boiling point | 128-130°C 0,5mm | | Fp | 128-130°C/0.5mm | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | color | yellow-brown | | Water Solubility | Insoluble in water. | | Sensitive | Air Sensitive | | BRN | 6556841 | | InChI | InChI=1S/C24H9F18P/c25-19(26,27)10-1-11(20(28,29)30)5-16(4-10)43(17-6-12(21(31,32)33)2-13(7-17)22(34,35)36)18-8-14(23(37,38)39)3-15(9-18)24(40,41)42/h1-9H | | InChIKey | ITJHLZVYLDBFOJ-UHFFFAOYSA-N | | SMILES | P(C1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1)(C1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1)C1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 | | CAS DataBase Reference | 175136-62-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | RIDADR | 3278 | | WGK Germany | 3 | | F | 10-23 | | Hazard Note | Irritant/Air Sensitive/Keep under nitrogen | | HS Code | 2931599090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Tris[3,5-bis(trifluoromethyl)phenyl]phosphine Usage And Synthesis |
| Uses | Tris[3,5-bis(trifluoromethyl)phenyl]phosphine is used as ligands which is useful as catalysts in various reactions. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand |
| | Tris[3,5-bis(trifluoromethyl)phenyl]phosphine Preparation Products And Raw materials |
|