- Z-GLY-GLY-OET
-
-
2025-12-24
- CAS:1145-81-9
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 10 tons
|
| | Z-Gly-Gly-OEt Basic information |
| Product Name: | Z-Gly-Gly-OEt | | Synonyms: | 2-(benzyloxycarbonylamino)acetic acid ethyl ester;ethyl 2-(phenylmethoxycarbonylamino)acetate;ethyl 2-(phenylmethoxycarbonylamino)ethanoate;Z-GLYCYL GLYCINE ETHYL ESTER;Ethyl 2-(((benzyloxy)carbonyl)aMino)acetate;Glycine, N-[(phenylMethoxy)carbonyl]-, ethyl ester;Ethyl carbobenzoxyglycinate;Ethyl N-(benzyloxycarbonyl)glycinate | | CAS: | 1145-81-9 | | MF: | C12H15NO4 | | MW: | 237.25 | | EINECS: | 807-876-0 | | Product Categories: | | | Mol File: | 1145-81-9.mol |  |
| | Z-Gly-Gly-OEt Chemical Properties |
| Melting point | 81-82℃ | | Boiling point | 376.3±35.0 °C(Predicted) | | density | 1.162±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 10.97±0.46(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C12H15NO4/c1-2-16-11(14)8-13-12(15)17-9-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3,(H,13,15) | | InChIKey | HAIHOTOFCDNWDA-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)CNC(OCC1=CC=CC=C1)=O |
| | Z-Gly-Gly-OEt Usage And Synthesis |
| Chemical Properties | White or off-white powder | | Synthesis Reference(s) | Journal of the American Chemical Society, 73, p. 3508, 1951 DOI: 10.1021/ja01151a512 |
| | Z-Gly-Gly-OEt Preparation Products And Raw materials |
|