Gentisuric acid manufacturers
- Gentisuric Acid
-
-
2026-06-30
- CAS:25351-24-0
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 10000KG
- GENTISURIC ACID
-
-
2025-12-24
- CAS:25351-24-0
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10
|
| | Gentisuric acid Basic information |
| Product Name: | Gentisuric acid | | Synonyms: | N-(2,5-DIHYDROXYBENZOYL)GLYCINE;2-[(2,5-Dihydroxybenzoyl)amino]acetic acid;[(2,5-Dihydroxybenzoyl)amino]acetic acid;GentisuricAcid>Glycine, N-(2,5-dihydroxybenzoyl)-;2-(2,5-Dihydroxybenzamido)acetic acid;(2,5-Dihydroxybenzoyl)glycine;Gentisuric acid | | CAS: | 25351-24-0 | | MF: | C9H9NO5 | | MW: | 211.17 | | EINECS: | | | Product Categories: | | | Mol File: | 25351-24-0.mol |  |
| | Gentisuric acid Chemical Properties |
| Melting point | 221-224°C | | Boiling point | 530.1±50.0 °C(Predicted) | | density | 1.532±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.67±0.10(Predicted) | | color | White to Off-White | | BRN | 18830886 | | InChI | InChI=1S/C9H9NO5/c11-5-1-2-7(12)6(3-5)9(15)10-4-8(13)14/h1-3,11-12H,4H2,(H,10,15)(H,13,14) | | InChIKey | FBFATOOJCPDQOZ-UHFFFAOYSA-N | | SMILES | C(O)(=O)CNC(=O)C1=CC(O)=CC=C1O |
| | Gentisuric acid Usage And Synthesis |
| Uses | Gentisuric Acid is a metabolite that was found in hen plasma, tissues, and eggs as a result of the consumption of naturally occurring salicylates. | | Definition | ChEBI: Gentisuric acid is a N-acylglycine. |
| | Gentisuric acid Preparation Products And Raw materials |
|