|
|
| | N-Ethyl-o-toluenesulfonamide Basic information |
| Product Name: | N-Ethyl-o-toluenesulfonamide | | Synonyms: | n-ethyl-2-methyl-benzenesulfonamid;n-ethyl-o-toluenesulfonamid;RIT-CIZER NO 8;N-E-O/PTSA;n-ethyl-o-toluenesulfonamide;N-Ethyl-o-Toluenesulfamide;Benzenesulfonamide, N-ethyl-2-methyl-;TOLUENEETHYLSULPHONAMIDE | | CAS: | 1077-56-1 | | MF: | C9H13NO2S | | MW: | 199.27 | | EINECS: | 214-073-3 | | Product Categories: | | | Mol File: | 1077-56-1.mol |  |
| | N-Ethyl-o-toluenesulfonamide Chemical Properties |
| Melting point | 18 | | Boiling point | 317.2±35.0 °C(Predicted) | | density | 1.153±0.06 g/cm3(Predicted) | | refractive index | (25) 1.540 | | Fp | 345 | | pka | 11.71±0.40(Predicted) | | form | Liquid | | Cosmetics Ingredients Functions | FILM FORMING
PLASTICISER | | InChI | InChI=1S/C9H13NO2S/c1-3-10-13(11,12)9-7-5-4-6-8(9)2/h4-7,10H,3H2,1-2H3 | | InChIKey | NATWUQFQFMZVMT-UHFFFAOYSA-N | | SMILES | C1(S(NCC)(=O)=O)=CC=CC=C1C | | CAS DataBase Reference | 1077-56-1(CAS DataBase Reference) | | EPA Substance Registry System | Benzenesulfonamide, N-ethyl-2-methyl- (1077-56-1) |
| | N-Ethyl-o-toluenesulfonamide Usage And Synthesis |
| Uses | N-Ethyl-o-toluenesulfonamide is a versatile chemical whose core value lies in its role as a highly effective plasticizer and a key intermediate in chemical synthesis. | | Application | N-Ethyl-o-toluenesulfonamide is used as a plasticizer for polyamides, cellulose acetate, and gasoline-resistant coatings, and is suitable for the manufacture of materials such as plastics, resins, paints, pigments, coatings, and printing inks. | | Health Hazard | N-Ethyl-o-toluenesulphonamide is an irritant; contact may cause mild skin and eye irritation. It may also cause drowsiness or dizziness. Harmful to aquatic organisms. |
| | N-Ethyl-o-toluenesulfonamide Preparation Products And Raw materials |
|