| Company Name: |
Twochem Co.Ltd Gold |
| Tel: |
021-021-58111628 15800915896 |
| Email: |
sales@twochem.com |
|
| | 4-Nitrophenyl-alpha-D-glucopyranoside Basic information |
| | 4-Nitrophenyl-alpha-D-glucopyranoside Chemical Properties |
| Melting point | 210-216 °C | | Boiling point | 442.39°C (rough estimate) | | density | 1.3709 (rough estimate) | | refractive index | 218.5 ° (C=0.5, H2O) | | storage temp. | Keep in dark place,Sealed in dry,Store in freezer, under -20°C | | solubility | DMF: 10 mg/ml,DMSO: 10 mg/ml,Ethanol: Slightly soluble,PBS (pH 7.2): 0.3 mg/ml | | pka | 12.55±0.70(Predicted) | | form | Crystalline Powder | | color | Off-white to light yellow | | Water Solubility | Soluble in water, warm ethanol and methanol. | | BRN | 92212 | | InChI | InChI=1/C12H15NO8/c14-5-8-9(15)10(16)11(17)12(21-8)20-7-3-1-6(2-4-7)13(18)19/h1-4,8-12,14-17H,5H2/t8-,9-,10+,11-,12+/s3 | | InChIKey | IFBHRQDFSNCLOZ-ZIQFBCGOSA-N | | SMILES | O(C1C=CC(N(=O)=O)=CC=1)[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |&1:10,12,15,17,19,r| | | CAS DataBase Reference | 3767-28-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-36-26 | | WGK Germany | 3 | | F | 3-10-21 | | HS Code | 29389090 | | Storage Class | 11 - Combustible Solids |
| | 4-Nitrophenyl-alpha-D-glucopyranoside Usage And Synthesis |
| Chemical Properties | White Crystals | | Uses | Substrate for a-glucosidase inhibitor | | Uses | p-Nitrophenyl α-D-Glucopyranoside is a substrate for α-glucosidase inhibitor. | | Definition | ChEBI: An alpha-D-glucoside that is beta-D-glucopyranose in which the anomeric hydroxy hydrogen is replaced by a 4-nitrophenyl group. | | Biological Activity | 4-Nitrophenyl ǥ-D-glucopyranoside serves as a substrate for glycosidases. Upon cleavage, the substrate is converted to a yellow-colored product. | | Purification Methods | Purify 4-nitrophenyl--D-glucopyranoside by recrystallisation from H2O, MeOH or EtOH. [Jermyn Aust J Chem 7 202 1954, Montgomery et al. J Am Chem Soc 64 690 1942.] It is a chromogenic substrate from -glucosidases [Oliviera et al. Anal Biochem 1 1 3 1881981], and is a C5227substrate for glucansucrases [Binder & Robyt Carbohydr Research 124 2871983]. [Beilstein 17/7 V 53.] |
| | 4-Nitrophenyl-alpha-D-glucopyranoside Preparation Products And Raw materials |
|