| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (4S,5R)-(-)-cis-4,5-Diphenyl-2-oxazolidinone Basic information |
| Product Name: | (4S,5R)-(-)-cis-4,5-Diphenyl-2-oxazolidinone | | Synonyms: | (4S,5R)-(-)-CIS-4,5-DIPHENYL-2-OXAZOLIDI;(4S,5R)-45-diphenyloxazolidin-2-one;(-)-cis-4,5-Diphenyl-2-oxazolidinone;(4S,5R)-(-)-cis-Diphenyl-2-oxazolidinone;(4S-cis)-4,5-Diphenyl-2-oxazolidinone;(4S,5R)-cis-4,5-Diphenyloxazolidin-2-one;(4S,5R)-4,5-Diphenyl-2-oxazolidinone;(4S,5R)-4,5-Diphenyl-2-oxazolidinone,99%e.e. | | CAS: | 23204-70-8 | | MF: | C15H13NO2 | | MW: | 239.27 | | EINECS: | | | Product Categories: | Asymmetric Synthesis;Chiral Auxiliaries;Oxazolidinone Derivatives | | Mol File: | 23204-70-8.mol |  |
| | (4S,5R)-(-)-cis-4,5-Diphenyl-2-oxazolidinone Chemical Properties |
| Melting point | 227-232 °C(lit.) | | Boiling point | 466.6±45.0 °C(Predicted) | | density | 1.192±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly) | | pka | 11.56±0.60(Predicted) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]23/D 57±4°, c = 2 in chloroform (or methanol) | | InChI | 1S/C15H13NO2/c17-15-16-13(11-7-3-1-4-8-11)14(18-15)12-9-5-2-6-10-12/h1-10,13-14H,(H,16,17)/t13-,14+/m0/s1 | | InChIKey | LTENIVFVXMCOQI-UONOGXRCSA-N | | SMILES | O=C1N[C@H]([C@H](O1)c2ccccc2)c3ccccc3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (4S,5R)-(-)-cis-4,5-Diphenyl-2-oxazolidinone Usage And Synthesis |
| Uses | (4S,5R)-(-)-cis-Diphenyl-2-oxazolidinone is used as a catalyst in the enantioselective synthesis of chiral phthalides. | | Uses | Versatile chiral auxiliary used in a variety of highly diastereoselective reactions such as Michael additions, Diels-Alder reactions, cyclopropanations, and allylations. |
| | (4S,5R)-(-)-cis-4,5-Diphenyl-2-oxazolidinone Preparation Products And Raw materials |
|