|
|
| | (1R,2S)-2-Amino-1,2-diphenylethanol Basic information |
| Product Name: | (1R,2S)-2-Amino-1,2-diphenylethanol | | Synonyms: | (1R,2S)-2-Amino-1,2-diphenylethanol,99%e.e.;(1R,2S)-2-Amino-1,2-diphenylethanol, min. 98%;(1R,2S)-(-)-2-AMino-1,2-diphenylethanol, ee: 99%;(1R,2S)-2-AMINO-1,2-DIPHENYLETHANOL;(1R,2S)-(-)-DIPHENYL-2-AMINOETHANOL;(1R,2S)-(-)-ERYTHRO-2-AMINO 1,2-DIPHENYLETHANOL;BENZENEETHANOL, B-AMINO-A-PHENYL-, (AR,BS)-;(1R,2S)-(-)-amino-1,2,-diphenylethanol | | CAS: | 23190-16-1 | | MF: | C14H15NO | | MW: | 213.28 | | EINECS: | | | Product Categories: | chiral;Chiral reagent;Amino Alcohols (Chiral);Chiral Building Blocks;for Resolution of Acids;Optical Resolution;Synthetic Organic Chemistry;Amino Alcohols & Deriv.;CHIRAL CHEMICALS;Chiral Compound;Amino Alcohols;Chiral Building Blocks;Organic Building Blocks | | Mol File: | 23190-16-1.mol |  |
| | (1R,2S)-2-Amino-1,2-diphenylethanol Chemical Properties |
| Melting point | 142-144 °C(lit.) | | alpha | -7 º (c=0.6, EtOH) | | Boiling point | 374.3±37.0 °C(Predicted) | | density | 1.148±0.06 g/cm3(Predicted) | | refractive index | -7 ° (C=0.6, EtOH) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform, Ethanol, Methanol | | pka | 11.70±0.45(Predicted) | | form | Powder | | color | white to light-yellow | | Optical Rotation | [α]25/D 7.0°, c = 0.6 in ethanol | | BRN | 2806218 | | InChI | InChI=1/C14H15NO/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-14,16H,15H2/t13-,14+/s3 | | InChIKey | GEJJWYZZKKKSEV-JJANDPSINA-N | | SMILES | [C@@H](C1C=CC=CC=1)(N)[C@@H](C1C=CC=CC=1)O |&1:0,8,r| | | CAS DataBase Reference | 23190-16-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10 | | HS Code | 29221990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (1R,2S)-2-Amino-1,2-diphenylethanol Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | (1R,2S)-(-)-2-Amino-1,2-diphenylethanol is a hydroxylated 1,2-diphenethylamine derivative with affinity for the NMDA receptor. | | Uses | Chiral auxiliary used for Pd(II)-assisted chiral tandem alkylation and carbonylative coupling reactions. |
| | (1R,2S)-2-Amino-1,2-diphenylethanol Preparation Products And Raw materials |
| Raw materials | 1,3-Dioxolan-2-one, 4,5-diphenyl-, (4R,5R)--->Formamide, N-[(1S,2S)-2-hydroxy-1,2-diphenylethyl]--->(E)-2-hydroxy-1,2-diphenylethan-1-one oxime-->trans-Stilbene oxide | | Preparation Products | (1S,2R)-2-Amino-1,2-diphenylethanol |
|