|
|
| | Testosterone isocaproate Basic information |
| Product Name: | Testosterone isocaproate | | Synonyms: | 17beta-hydroxyandrost-4-ene-3-one 4-methylvalerate;4-ANDROSTEN-17-BETA-OL-3-ONE ISOCAPROATE;-10,13-Dimethyl-3-oxo-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl 4-methylpentanoate;Testosterone isocaproate(15262-86-9);3-oxoandrost-4-en-17-yl 4-methylpentanoate;4-methylpentanoic acid [(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] ester;Testosterone Isocaproate for System Suit;Steroids Testosterone Isocaproate CAS 15262-86-9 | | CAS: | 15262-86-9 | | MF: | C25H38O3 | | MW: | 386.57 | | EINECS: | 239-307-1 | | Product Categories: | testosterone;API;Steroid and Hormone;Steroids;15262-86-9 | | Mol File: | 15262-86-9.mol |  |
| | Testosterone isocaproate Chemical Properties |
| Melting point | 79-80 °C | | Boiling point | 487.6±45.0 °C(Predicted) | | density | 1.07±0.1 g/cm3(Predicted) | | solubility | Practically insoluble in water, very soluble in acetone and in methylene chloride, freely soluble in fatty oils. | | InChI | InChI=1/C25H38O3/c1-16(2)5-10-23(27)28-22-9-8-20-19-7-6-17-15-18(26)11-13-24(17,3)21(19)12-14-25(20,22)4/h15-16,19-22H,5-14H2,1-4H3/t19-,20-,21-,22-,24-,25-/s3 | | InChIKey | PPYHLSBUTAPNGT-BKWLFHPQSA-N | | SMILES | [C@@]12([H])CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@H](CC[C@@]21[H])OC(=O)CCC(C)C |&1:0,10,12,16,18,21,r| | | CAS DataBase Reference | 15262-86-9(CAS DataBase Reference) |
| | Testosterone isocaproate Usage And Synthesis |
| Description | Testosterone isocaproate is a testosterone ester with improved bioavailability and metabolic half life compared to the endogenous hormone.It used to testosterone replacement therapy in sterilization, missing testicle, hypopituitarism, and osteoporosis. | | Chemical Properties | White or almost white powder. | | Uses | Testosterone Isocaproate is used in the treatment of male hypogonadism (a condition in which the body does not produce enough testosterone). | | Definition | ChEBI: Testosterone isocaproate is a steroid ester. | | Side effects |
Acne, Injection site pain, Weight gain, Prostate enlargement, Increased red blood cells, Dizziness, Diarrhea
| | Mode of action | Testosterone Isocaproate is similar to the natural male hormone, testosterone. Testosterone binds to the androgen receptor (AR), and the ligand-receptor complex translocates to the nucleus and binds to androgen response elements (AREs) on chromosomal DNA, thereby modulating transcription of a set of androgen-responsive genes. Testosterone can also be converted to estrogen and has a similar regulatory action on genes containing estrogen response elements (EREs). |
| | Testosterone isocaproate Preparation Products And Raw materials |
|