| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | Fmoc-4-amino-3-hydroxybutanoic acid Basic information |
| Product Name: | Fmoc-4-amino-3-hydroxybutanoic acid | | Synonyms: | 4-(Fmoc-amino)-3-hydroxybutanoic acid;4-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-3-hydroxybutanoic acid;Butanoic acid, 4-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-3-hydroxy-;Fmoc-4-amino-3-hydroxybutanoic acid | | CAS: | 184763-08-4 | | MF: | C19H19NO5 | | MW: | 341.36 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | Fmoc-4-amino-3-hydroxybutanoic acid Chemical Properties |
| Boiling point | 618.7±55.0 °C(Predicted) | | density | 1.329±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 4.28±0.10(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C19H19NO5/c21-12(9-18(22)23)10-20-19(24)25-11-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-8,12,17,21H,9-11H2,(H,20,24)(H,22,23) | | InChIKey | KAVHFNYDXGWPBX-UHFFFAOYSA-N | | SMILES | OC(CNC(=O)OCC1c2ccccc2-c3ccccc13)CC(O)=O |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Fmoc-4-amino-3-hydroxybutanoic acid Usage And Synthesis |
| | Fmoc-4-amino-3-hydroxybutanoic acid Preparation Products And Raw materials |
|