|
|
| | meso-2,3-Dibromosuccinic acid Basic information |
| Product Name: | meso-2,3-Dibromosuccinic acid | | Synonyms: | meso-2,3-Dibromosuccinic acid;meso-2,3-Dibromosuccinicacid,98%;MESO-2,3-Dibromosuccinic acid ,99%;2,3-dibroMosuccinate;Meso-2,3-DibroMosuccini;2,3-DibroM succinic acid;Meso-2,3-DibroMosuccinic acid 98%;meso-2,3-Dibromosuccinic | | CAS: | 608-36-6 | | MF: | C4H4Br2O4 | | MW: | 275.88 | | EINECS: | 208-396-9 | | Product Categories: | Carboxylic Acid Monomers;Monomers;Polymer Science;bc0001 | | Mol File: | 608-36-6.mol |  |
| | meso-2,3-Dibromosuccinic acid Chemical Properties |
| Melting point | 288-290 °C(lit.) | | Boiling point | 262.4±40.0 °C(Predicted) | | density | 2.486±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | 20 g/L (17°C) | | form | Powder | | pka | pK1:1.51;pK2:2.71 (20°C) | | color | White to pale yellow to beige | | Water Solubility | 20 g/L (17 ºC) | | Merck | 14,3029 | | BRN | 1725173 | | InChI | 1S/C4H4Br2O4/c5-1(3(7)8)2(6)4(9)10/h1-2H,(H,7,8)(H,9,10)/t1-,2+ | | InChIKey | FJWGRXKOBIVTFA-XIXRPRMCSA-N | | SMILES | OC(=O)[C@@H](Br)[C@@H](Br)C(O)=O | | CAS DataBase Reference | 608-36-6(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 34-36/37/38 | | Safety Statements | 26-36/37/39-45-24/25 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29171900 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | meso-2,3-Dibromosuccinic acid Usage And Synthesis |
| Chemical Properties | white to pale yellow-beige powder | | Uses | meso-2,3-dibromosuccinic acid is used in organic synthesis & pharmaceutical intermediate. | | Purification Methods | Crystallise the acid from distilled water, keeping the temperature below 70o. [Beilstein 2 IV 1930.] |
| | meso-2,3-Dibromosuccinic acid Preparation Products And Raw materials |
|