- Methyl 3-nitrobenzoate
-
- $43.26
-
2026-07-16
- CAS:618-95-1
- Min. Order: 25Kg/Drum
- Purity: 99.00%HPLC
- Supply Ability: 16tons/month
|
| | Methyl 3-nitrobenzoate Basic information |
| | Methyl 3-nitrobenzoate Chemical Properties |
| Melting point | 78-80 °C (lit.) | | Boiling point | 279 °C (lit.) | | density | 1.4283 (rough estimate) | | refractive index | 1.5468 (estimate) | | Fp | 279°C | | storage temp. | Sealed in dry,Room Temperature | | form | Crystalline Powder | | color | Beige | | Water Solubility | insoluble | | BRN | 392449 | | Stability: | Stable. Incompatible with strong oxidizing agents. | | InChI | 1S/C8H7NO4/c1-13-8(10)6-3-2-4-7(5-6)9(11)12/h2-5H,1H3 | | InChIKey | AXLYJLKKPUICKV-UHFFFAOYSA-N | | SMILES | COC(=O)c1cccc(c1)[N+]([O-])=O | | CAS DataBase Reference | 618-95-1(CAS DataBase Reference) | | NIST Chemistry Reference | 3-O2N-C6H4-COOCH3(618-95-1) | | EPA Substance Registry System | Benzoic acid, 3-nitro-, methyl ester (618-95-1) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29163900 | | Storage Class | 11 - Combustible Solids |
| | Methyl 3-nitrobenzoate Usage And Synthesis |
| Chemical Properties | beige crystalline powder | | Uses | Methyl 3-nitrobenzoate was used in the preparation of iodoarene. | | Synthesis Reference(s) | Synthetic Communications, 22, p. 1851, 1992 DOI: 10.1080/00397919208021316
Chemical and Pharmaceutical Bulletin, 36, p. 481, 1988 DOI: 10.1248/cpb.36.481 | | Purification Methods | Crystallise the benzoate from MeOH (1g/mL). [Beilstein 9 H 378, 9 I 153, 9 II 248, 9 III 1493, 9 IV 1056.] |
| | Methyl 3-nitrobenzoate Preparation Products And Raw materials |
|