| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
3-NITROBENZHYDRAZIDE manufacturers
- 3-nitrobenzohydrazide
-
- $68.37
-
2026-09-11
- CAS:618-94-0
- Min. Order: 25Kg/Drum
- Purity: 99.00%, 98.00%HPLC
- Supply Ability: 15tons/month
|
| | 3-NITROBENZHYDRAZIDE Basic information |
| | 3-NITROBENZHYDRAZIDE Chemical Properties |
| Melting point | 153-154°C | | density | 1.406 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder to crystal | | pka | 11.45±0.10(Predicted) | | color | White to Light yellow | | BRN | 645512 | | InChI | InChI=1S/C7H7N3O3/c8-9-7(11)5-2-1-3-6(4-5)10(12)13/h1-4H,8H2,(H,9,11) | | InChIKey | NQEWXLVDAVTOHM-UHFFFAOYSA-N | | SMILES | C(NN)(=O)C1=CC=CC([N+]([O-])=O)=C1 | | CAS DataBase Reference | 618-94-0(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 3-nitro-, hydrazide (618-94-0) |
| Provider | Language |
|
ALFA
| English |
| | 3-NITROBENZHYDRAZIDE Usage And Synthesis |
| Application | 3-Nitrobenzhydrazide is a useful research chemical. |
| | 3-NITROBENZHYDRAZIDE Preparation Products And Raw materials |
|