P-NITROSOTOLUENE manufacturers
- P-NITROSOTOLUENE
-
- $1.00
-
2020-01-09
- CAS:623-11-0
- Min. Order: 1ASSAYS
- Purity: 85.0-99.8%
- Supply Ability: 20tons
|
| | P-NITROSOTOLUENE Basic information |
| Product Name: | P-NITROSOTOLUENE | | Synonyms: | P-NITROSOTOLUENE;Benzene, 1-methyl-4-nitroso-;4-nitrosotoluene;PARA-NITROSOTOLUENE;1-Nitroso-4-methylbenzene;4-Methyl-1-nitrosobenzene;Nifedipine Impurity 38;1-Methyl-4-nitrosobenzene | | CAS: | 623-11-0 | | MF: | C7H7NO | | MW: | 121.14 | | EINECS: | 210-771-7 | | Product Categories: | | | Mol File: | 623-11-0.mol |  |
| | P-NITROSOTOLUENE Chemical Properties |
| Melting point | 48 °C | | Boiling point | 196.2±19.0 °C(Predicted) | | density | 1.03±0.1 g/cm3(Predicted) | | InChI | InChI=1S/C7H7NO/c1-6-2-4-7(8-9)5-3-6/h2-5H,1H3 | | InChIKey | NYJYFSGMYHSTNZ-UHFFFAOYSA-N | | SMILES | C1(C)=CC=C(N=O)C=C1 |
| | P-NITROSOTOLUENE Usage And Synthesis |
| Synthesis Reference(s) | The Journal of Organic Chemistry, 38, p. 2088, 1973 DOI: 10.1021/jo00951a025 |
| | P-NITROSOTOLUENE Preparation Products And Raw materials |
|