|
|
| | (S)-Piperazine-2-carboxylic acid dihydrochloride Basic information |
| | (S)-Piperazine-2-carboxylic acid dihydrochloride Chemical Properties |
| Melting point | 280°C | | alpha | -5 º (c=1% in H2O) | | storage temp. | Inert atmosphere,Room Temperature | | form | solid | | color | White | | Optical Rotation | [α]20/D 5±1°, c = 1% in H2O | | Sensitive | Hygroscopic | | BRN | 7312035 | | InChI | InChI=1/C5H10N2O2.2ClH/c8-5(9)4-3-6-1-2-7-4;;/h4,6-7H,1-3H2,(H,8,9);2*1H/t4-;;/s3 | | InChIKey | WNSDZBQLMGKPQS-FPXZQKKRNA-N | | SMILES | N1CCNC[C@H]1C(O)=O.[H]Cl.[H]Cl |&1:5,r| | | CAS DataBase Reference | 158663-69-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 3-10 | | HS Code | 2933599590 |
| | (S)-Piperazine-2-carboxylic acid dihydrochloride Usage And Synthesis |
| Uses | Preparation of (S)-piperazine-2-carboxylic acid, (R)-piperazine-2-carboxylic acid, and (S)-piperidine-2-carboxylic acid by kinetic resolution of the corresponding racemic carboxamides with stereoselective amidases in whole bacterial cells. |
| | (S)-Piperazine-2-carboxylic acid dihydrochloride Preparation Products And Raw materials |
|