| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | (R)-(+)-2-Piperazinecarboxylic acid dihydrochloride Basic information |
| | (R)-(+)-2-Piperazinecarboxylic acid dihydrochloride Chemical Properties |
| Melting point | ca 265℃ | | Fp | 143.5℃ | | storage temp. | Inert atmosphere,Room Temperature | | form | solid | | Appearance | White to off-white Solid | | Optical Rotation | [α]20/D +5±1°, c = 1% in H2O | | InChI | InChI=1/C5H10N2O2.2ClH/c8-5(9)4-3-6-1-2-7-4;;/h4,6-7H,1-3H2,(H,8,9);2*1H/t4-;;/s3 | | InChIKey | WNSDZBQLMGKPQS-RZFWHQLPSA-N | | SMILES | [C@H]1(C(=O)O)NCCNC1.Cl.Cl |&1:0,r| | | CAS DataBase Reference | 126330-90-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 3-10 | | HS Code | 29335990 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (R)-(+)-2-Piperazinecarboxylic acid dihydrochloride Usage And Synthesis |
| Chemical Properties | White solid | | Uses | (R)-2-Piperazinecarboxylic acid dihydrochloride can be used as a starting material for the synthesis of (R)-enantiomers of anthramycin analogs, which are potential antiproliferative agents. It can also be employed in the preparation of piperazinemethanol chiral ligands, which can be utilized in the enantioselective borane reduction of aromatic ketones, ketimine, and oxime ether. | | Synthesis | As a method for the preparation of racemic 2-piperazine carboxylic acids by optical splitting, it is known to use cyclic camphorsulfonic acid as a splitting agent, racemic 2-piperazine carboxylic acids and cyclic camphorsulfonic acid are made to be dissolved in a solvent and the resultant solution is treated with activated charcoal to remove the color, after which (R)-piperazine-2-carboxylic acid dihydrochloride is precipitated. |
| | (R)-(+)-2-Piperazinecarboxylic acid dihydrochloride Preparation Products And Raw materials |
|