|
|
| | 1-Indanecarboxylic acid Basic information |
| Product Name: | 1-Indanecarboxylic acid | | Synonyms: | indan-1-carboxylic acid;3-09-00-02776 (Beilstein Handbook Reference);2,3-dihydro-1H-indene-1-carboxylic acid;1H-Indene-1-carboxylic acid, 2,3-dihydro-;1-Indancarboxylic acid;Brn 1868207;Einecs 238-355-0;Indane-1-carboxylic acid | | CAS: | 14381-42-1 | | MF: | C10H10O2 | | MW: | 162.19 | | EINECS: | 238-355-0 | | Product Categories: | | | Mol File: | 14381-42-1.mol |  |
| | 1-Indanecarboxylic acid Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | form | solid | | Boiling point | 324.6±21.0 °C(Predicted) | | density | 1.240±0.06 g/cm3(Predicted) | | Melting point | 59-60 °C | | pKa | 4.23±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H10O2/c11-10(12)9-6-5-7-3-1-2-4-8(7)9/h1-4,9H,5-6H2,(H,11,12) | | InChIKey | JBQMFBWTKWOSQX-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)C2=C(C=CC=C2)CC1 |
| WGK Germany | WGK 3 | | HS Code | 2916200090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| | 1-Indanecarboxylic acid Usage And Synthesis |
| Uses | 1-Indanecarboxylic acid is an organic intermediate compound used in the preparation of 1-indanecarbonitrile, 6-Chloroindan-1-carboxylic acid and 6-Bromo-2,3-dihydro-1H-indene-1-carboxylic acid, among other chemical products. |
| | 1-Indanecarboxylic acid Preparation Products And Raw materials |
|