(E)-tetradec-12-enyl acetate manufacturers
|
| | (E)-tetradec-12-enyl acetate Basic information |
| Product Name: | (E)-tetradec-12-enyl acetate | | Synonyms: | (E)-tetradec-12-enyl acetate;(12E)-Tetradecen-1-yl acetate;(E)-12-Tetradecen-1-ol acetate;Acetic acid (12E)-12-tetradecenyl ester;(E)-12-Tetradecenyl acetate;12-Tetradecen-1-ol, 1-acetate, (12E)-;12E-Tetradecenyl acetate;(E)-Tetradec-12-en-1-yl acetate | | CAS: | 35153-21-0 | | MF: | C16H30O2 | | MW: | 254.41 | | EINECS: | 252-403-8 | | Product Categories: | | | Mol File: | 35153-21-0.mol |  |
| | (E)-tetradec-12-enyl acetate Chemical Properties |
| Boiling point | 316.2±11.0 °C(Predicted) | | density | 0.878±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C16H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h3-4H,5-15H2,1-2H3/b4-3+ | | InChIKey | CRJBZFQLVNBSHX-ONEGZZNKSA-N | | SMILES | C(OC(=O)C)CCCCCCCCCC/C=C/C | | EPA Substance Registry System | 12-Tetradecen-1-ol, acetate, (12E)- (35153-21-0) |
| | (E)-tetradec-12-enyl acetate Usage And Synthesis |
| Uses | O. furnacalis produces a 3∶2 blend of (Z) and (E)-tetradec-12-enyl acetate as sex pheromone[1]. | | Definition | ChEBI: 12E-Tetradecenyl acetate is a carboxylic ester. | | References |
[1] Wanner, K. W., Nichols, A. S., Allen, J. E., Bunger, P. L., Garczynski, S. F., Linn, C. E., Robertson, H. M., & Luetje, C. W. (2010). Sex pheromone receptor specificity in the European corn borer moth, Ostrinia nubilalis. ACS Applied Bio Materials, e8685. https://doi.org/10.1371/journal.pone.0008685
|
| | (E)-tetradec-12-enyl acetate Preparation Products And Raw materials |
|