| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Boc-2-Methoxy-L-Phenylalanine Basic information |
| Product Name: | Boc-2-Methoxy-L-Phenylalanine | | Synonyms: | Boc-2-Methoxy-L-Phenylalanine;Boc-L-Phe(2-OMe)-OH;(Tert-Butoxy)Carbonyl 2-Methoxy-L-Phenylalanine;(2S)-2-{[(tert-butoxy)carbonyl]amino}-3-(2-methoxyphenyl)propanoic acid;L-Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-2-methoxy-;Boc-2-methoxy-L-phenylalanine 97%;(S)-2-TERT-BUTHOXYCARBONYLAMINO-3-(2-METHOXY-PHENYL)-PROPIONIC ACID;(S)-2-((tert-Butoxycarbonyl)amino)-3-(2-methoxyphenyl)propanoic acid | | CAS: | 143415-63-8 | | MF: | C15H21NO5 | | MW: | 295.33 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | Boc-2-Methoxy-L-Phenylalanine Chemical Properties |
| Melting point | 157°C | | Boiling point | 451.664±40.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.169±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 2-8°C | | form | powder | | pka | 3.956±0.11(predicted) | | color | White to off-white | | Major Application | peptide synthesis | | InChI | 1S/C15H21NO5/c1-15(2,3)21-14(19)16-11(13(17)18)9-10-7-5-6-8-12(10)20-4/h5-8,11H,9H2,1-4H3,(H,16,19)(H,17,18)/t11-/m0/s1 | | InChIKey | QMHKMTAKTUUKEK-NSHDSACASA-N | | SMILES | OC([C@@H](NC(OC(C)(C)C)=O)CC1=CC=CC=C1OC)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Boc-2-Methoxy-L-Phenylalanine Usage And Synthesis |
| Uses | Unnatural amino acid was derived from a C-H Activation methodology developed by Jin-Quan Yu and coworkers. The Pd-mediated C-C bond formation can be made in tandem with 2-Methylpyridine (Aldrich 109835). | | reaction suitability | reaction type: Boc solid-phase peptide synthesis
reagent type: ligand
reaction type: C-H Activation |
| | Boc-2-Methoxy-L-Phenylalanine Preparation Products And Raw materials |
|