| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-(4-Bromophenyl)thiophene-2-carboxylic Basic information |
| | 4-(4-Bromophenyl)thiophene-2-carboxylic Chemical Properties |
| Melting point | 238-242 °C | | Boiling point | 410.6±35.0 °C(Predicted) | | density | 1.637±0.06 g/cm3(Predicted) | | form | solid | | pka | 3.43±0.10(Predicted) | | InChI | 1S/C11H7BrO2S/c12-9-3-1-7(2-4-9)8-5-10(11(13)14)15-6-8/h1-6H,(H,13,14) | | InChIKey | PZHUPHYFDBYWCQ-UHFFFAOYSA-N | | SMILES | OC(=O)c1cc(cs1)-c2ccc(Br)cc2 |
| Hazard Codes | Xi | | Risk Statements | 22-36 | | Safety Statements | 26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 Eye Irrit. 2 |
| | 4-(4-Bromophenyl)thiophene-2-carboxylic Usage And Synthesis |
| | 4-(4-Bromophenyl)thiophene-2-carboxylic Preparation Products And Raw materials |
|