| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | trans-3-Chloro-4,5-dimethoxy-beta-nitro& Basic information |
| | trans-3-Chloro-4,5-dimethoxy-beta-nitro& Chemical Properties |
| Melting point | 163-167 °C (lit.) | | form | solid | | InChI | 1S/C10H10ClNO4/c1-15-9-6-7(3-4-12(13)14)5-8(11)10(9)16-2/h3-6H,1-2H3/b4-3+ | | InChIKey | AYULBTLOYLJHSB-ONEGZZNKSA-N | | SMILES | [H]\C(=C(\[H])[N+]([O-])=O)c1cc(Cl)c(OC)c(OC)c1 |
| Hazard Codes | Xi | | Risk Statements | 43 | | Safety Statements | 36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | trans-3-Chloro-4,5-dimethoxy-beta-nitro& Usage And Synthesis |
| | trans-3-Chloro-4,5-dimethoxy-beta-nitro& Preparation Products And Raw materials |
|