| Identification | Back Directory | [Name]
XPhos Pd G2 | [CAS]
1310584-14-5 | [Synonyms]
XPhos Pd G2 Palladium-Xphos -amino-1,1' -biphenyl)(2' -tri-i-propyl-1,1' Chloro(2-dicyclohexylphosphin 2nd Generation XPhos Precatalyst Chloro(2-dicyclohexylphosphino-2' -biphenyl-2-yl) palladium(II), min. 98% X-Phos aminobiphenyl palladium chloride precatalyst Chloro(2-dicyclohexylphosphino-2',4',6'-triisopropyl-1,1'-biphenyl)[2-(2'-aMino-1,1'-biphenyl)]palladiuM(II) Chloro(2-dicyclohexylphosphino-2',4',6'-tri-i-propyl-1,1'-biphenyl)(2'-amino-1,1'-biphenyl-2-yl) palladium(II) chloro(2-dicyclohexylphosphino-2',4',6'-triisoporpyl-1,1'-biphenyl)[2-(2'-amino-1,1'-biphenyl)] palladium (II) (SP-4-4)-[2'-Amino[1,1'-biphenyl]-2-yl]chloro[dicyclohexyl[2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine]palladium Chloro(2-dicyclohexylphosphino-2',4',6'-tri-i-propyl-1,1'-biphenyl)(2'-amino-1,1'-biphenyl-2-yl) palladium(II), min. 98% [XPhos Palladacycle Gen. 2] Chloro(2-dicyclohexylphosphino-2',4',6'-tri-i-propyl-1,1'-biphenyl)(2'-aMino-1,1'-biphenyl-2-yl) palladiuM(II), Min. 98% [XPhos Palladacycle] | [Molecular Formula]
C45H58ClNPPd+2 | [MDL Number]
MFCD07370072 | [MOL File]
1310584-14-5.mol | [Molecular Weight]
785.795 |
| Chemical Properties | Back Directory | [Melting point ]
202-210°C | [storage temp. ]
Inert atmosphere,2-8°C | [form ]
Powder | [color ]
white | [InChIKey]
USWOVTRTHZODCW-UHFFFAOYSA-N | [SMILES]
C1(C2=CC=CC=C2N)=CC=CC=C1[Pd+2].C1(C2=C(C(C)C)C=C(C(C)C)C=C2C(C)C)=CC=CC(Cl)=C1P(C1CCCCC1)C1CCCCC1 |
| Hazard Information | Back Directory | [Chemical Properties]
Chloro(2-dicyclohexylphosphino-2',4',6'-triisopropyl-1,1'-biphenyl)[2-(2'-amino-1,1'-biphenyl)]palladium(II) is a white solid powder at ambient temperature and pressure, and can be dissolved in common organic solvents, such as tetrahydrofuran. It belongs to a kind of nitrogen-phosphorus ligand complex of transition metal palladium, and is often used as a catalyst in organic synthesis, mostly used to catalyze coupling reactions and activation reactions of inert chemical bonds. | [Uses]
XPhos Pd G2 is a used as a catalyst in chemical reactions. | [Application]
XPhos Pd G2 is a second-generation Buchwald catalyst typically used for palladium-catalyzed Suzuki-Miyaura cross-coupling reactions. | [General Description]
XPhos Pd G2 is a bulky monodentate biaryl ligand. It is a Buchwald′s 2nd generation preformed catalyst. It undergoes rapid reductive elimination to form a reactive, monoligated Pd(0) species. | [reaction suitability]
reagent type: catalyst reaction type: Cross Couplings |
|
|