| Identification | Back Directory | [Name]
Chloro[(tricyclohexylphosphine)-2-(2'-aminobiphenyl)]palladium(II) | [CAS]
1353658-81-7 | [Synonyms]
PCy3 Pd G2 PCy3 Palladacycle Gen.2 Tricyclohexylphosphine Pd G2 Chloro[(tricyclohexylphosphine)-2-(2'-aminobiphenyl)]palladium(II) Chloro[(tricyclohexylphosphine)(2'-aminobiphenyl-2-yl)palladium(II) Chloro[(tricyclohexylphosphine)(2'-aminobiphenyl-2-yl)palladium(II) / PCy3 Pd G2 (SP-4-3)-[2'-(Amino)[1,1'-biphenyl]-2-yl]chloro(tricyclohexylphosphine)palladium (SP-4-3)-[2'-(Amino-κN)[1,1'-biphenyl]-2-yl-κC]chloro(tricyclohexylphosphine)palladium Chloro[(tricyclohexylphosphine)-2-(2'-aminobiphenyl)]palladium(II) ISO 9001:2015 REACH | [Molecular Formula]
C30H42ClNPPd+2 | [MDL Number]
MFCD21363051 | [MOL File]
1353658-81-7.mol | [Molecular Weight]
589.508 |
| Chemical Properties | Back Directory | [Melting point ]
244-246 °C | [storage temp. ]
2-8°C, protect from light, stored under nitrogen | [form ]
solid | [InChIKey]
YJEJUSIMNMMILB-UHFFFAOYSA-N | [SMILES]
C1(C2=CC=CC=C2N)=CC=CC=C1[Pd+2].P(C1CCCCC1)(C1CCCCC1)C1(Cl)CCCCC1 |
| Hazard Information | Back Directory | [Uses]
PCy3 Pd G2 is a monophosphine-coordinated 2-phenylaniline-based palladacycle complex that can be used as a precatalyst:
- To prepare diarylmethanes by Suzuki cross-coupling reaction with heterocyclic-chloromethyl derivatives with aryl/heteroaryl boronic acids.
- To synthesize poly(arylene)s by the Suzuki cross-coupling polymerization reaction between aryl dihalides and aryldiboronic acids.
- In the C-H bond functionalization reactions.
| [reaction suitability]
core: palladium reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: C-H Activation reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst reaction type: Cross Couplings |
|
|