|
|
| | 2S-(2alpha,3alpha,beta,7alpha,beta-octahydro-1H-indole-2-carboxylic acid phenyl methyl ester Basic information |
| Product Name: | 2S-(2alpha,3alpha,beta,7alpha,beta-octahydro-1H-indole-2-carboxylic acid phenyl methyl ester | | Synonyms: | Perindopril Intermediate 4;(2S,3aS,7aS)-Octahydro-1H-indole-2-carboxylic acid phenylmethyl ester 4-methylbenzenesulfonate;(2S,3AS,7aS)-Benzyl octahydro-1H-indole-2-carboxylate 4-methylbenzenesulfonate;(2S,3aS,7aS)-benzyl octahydro-1H-indole-2-carboxylate p-toluenesulfonic acid;(2S,3aS,7aS)-Octahydroindole-2- carboxylic acid benzyl ester 4-methylbenzenesulfonate;(2S, 3aS, 7aS) - Octahydroindole-2-carboxylic acid benzyl ester p-toluenesulfonate;(2S, 3aS, 7aS) - Octahydroindole-2-carboxylate benzyl ester p-toluenesulfonate;[2S-(2alpha,3alpha,beta,7alpha,beta]-Octahydro-1H-Indole-2-Carboxylic acid phenyl methyl ester, CAS 94062-52-9 | | CAS: | 94062-52-9 | | MF: | C23H29NO5S | | MW: | 431.55 | | EINECS: | 618-998-7 | | Product Categories: | Heterocycle-Indole series | | Mol File: | 94062-52-9.mol |  |
| | 2S-(2alpha,3alpha,beta,7alpha,beta-octahydro-1H-indole-2-carboxylic acid phenyl methyl ester Chemical Properties |
| storage temp. | 2-8°C | | InChIKey | PTLASYHTXGUCJU-JWCHSZRKNA-N | | SMILES | S(C1C=CC(C)=CC=1)(O)(=O)=O.C([C@H]1N[C@@]2([H])CCCC[C@@]2([H])C1)(=O)OCC1C=CC=CC=1 |&1:12,14,20,r| |
| | 2S-(2alpha,3alpha,beta,7alpha,beta-octahydro-1H-indole-2-carboxylic acid phenyl methyl ester Usage And Synthesis |
| Chemical Properties | Off-White to white crystalline powder |
| | 2S-(2alpha,3alpha,beta,7alpha,beta-octahydro-1H-indole-2-carboxylic acid phenyl methyl ester Preparation Products And Raw materials |
|