|
|
| | N-[(S)-1-Carbethoxy-1-butyl]-(S)-alanine Basic information |
| | N-[(S)-1-Carbethoxy-1-butyl]-(S)-alanine Chemical Properties |
| Melting point | 145-150°C | | Boiling point | 324.1±27.0 °C(Predicted) | | density | 1.079±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform, DMSO, Methanol | | form | Solid | | pka | 2.15±0.10(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C10H19NO4/c1-4-6-8(10(14)15-5-2)11-7(3)9(12)13/h7-8,11H,4-6H2,1-3H3,(H,12,13)/t7-,8-/m0/s1 | | InChIKey | AUVAVXHAOCLQBF-YUMQZZPRSA-N | | SMILES | C(OCC)(=O)[C@H](CCC)N[C@H](C(O)=O)C | | LogP | 0.3 at 25℃ and pH6 | | CAS DataBase Reference | 82834-12-6(CAS DataBase Reference) |
| | N-[(S)-1-Carbethoxy-1-butyl]-(S)-alanine Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | Perindopril intermediate |
| | N-[(S)-1-Carbethoxy-1-butyl]-(S)-alanine Preparation Products And Raw materials |
|