- Boc-L-Homophe-OH
-
-
2026-09-17
- CAS:100564-78-1
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
|
| | Boc-L-homophenylalanine Basic information |
| | Boc-L-homophenylalanine Chemical Properties |
| Melting point | 76-80 °C | | Boiling point | 439.6±38.0 °C(Predicted) | | density | 1.139 | | storage temp. | 2-8°C | | solubility | Soluble in methanol. | | pka | 3.95±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]20/D +6.5±1°, c = 2% in ethanol | | BRN | 3653506 | | Major Application | peptide synthesis | | InChI | InChI=1/C15H21NO4/c1-15(2,3)20-14(19)16-12(13(17)18)10-9-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H,16,19)(H,17,18)/t12-/s3 | | InChIKey | MCODLPJUFHPVQP-LBPRGKRZSA-N | | SMILES | [C@@H](C(=O)O)(CCC1=CC=CC=C1)NC(=O)OC(C)(C)C |&1:0,r| | | CAS DataBase Reference | 100564-78-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 3-10 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | Boc-L-homophenylalanine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | N-Boc-L-homophenylalanine is a useful reagent for organic synthesis and other chemical processes. It is used in the preparation of piperidine-containing peptidyl proteasome inhibitors. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-L-homophenylalanine Preparation Products And Raw materials |
|