| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- Boc-D-Homophe-OH
-
-
2026-09-15
- CAS:82732-07-8
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- Boc-D-Homophe-OH
-
- $1.00
-
2020-01-06
- CAS:82732-07-8
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 100KG
|
| | Boc-D-homophenylalanine Basic information |
| | Boc-D-homophenylalanine Chemical Properties |
| Melting point | 71-78℃ | | Boiling point | 439.6±38.0 °C(Predicted) | | density | 1.139 | | storage temp. | Sealed in dry,Room Temperature | | form | Powder | | pka | 3.95±0.10(Predicted) | | color | White to off-white | | Optical Rotation | [α]/D -6.5±1.0°, c = 2 in ethanol | | Water Solubility | Slightly soluble in water. | | BRN | 3653505 | | Major Application | peptide synthesis | | InChI | 1S/C15H21NO4/c1-15(2,3)20-14(19)16-12(13(17)18)10-9-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H,16,19)(H,17,18)/t12-/m1/s1 | | InChIKey | MCODLPJUFHPVQP-GFCCVEGCSA-N | | SMILES | CC(C)(C)OC(=O)N[C@H](CCc1ccccc1)C(O)=O | | CAS DataBase Reference | 82732-07-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | Boc-D-homophenylalanine Usage And Synthesis |
| Chemical Properties | White crystalline | | Uses | (R)-2-(Boc-amino)-4-phenylbutyric acid is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff fields. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-D-homophenylalanine Preparation Products And Raw materials |
|