- FMOC-PRO-OPFP
-
- $2.00 / 1KG
-
2020-01-15
- CAS: 86060-90-4
- Min. Order: 1g
- Purity: 98%min
- Supply Ability: ask
|
| | FMOC-PRO-OPFP Basic information |
| Product Name: | FMOC-PRO-OPFP | | Synonyms: | N-(9-fluorenylmethoxycarbonyl)-L-proline pentafluorophenyl;Fmoc-L-proline pentafluorophenyl ester, N-(9-Fluorenylmethoxycarbonyl)-L-proline pentafluorophenyl ester;N-(9-Fluorenylmethoxycarbonyl)-L-proline pentafluorophenyl ester,97%;N-(Fluorenylmethoxycarbonyl)proline pentafluorophenyl ester;Fmoc-Pro-OP;(S)-Fmoc-pyrrolidine-2-carboxylic acid pentafluorophenyl ester;Fmoc-L-proline pentafluorophenyl ester≥ 99% (HPLC);N-ALPHA-FMOC-L-PROLINE PENTAFLUOROPHENYL ESTER | | CAS: | 86060-90-4 | | MF: | C26H18F5NO4 | | MW: | 503.42 | | EINECS: | | | Product Categories: | Fmoc-Amino Acids and Derivatives;Amino Acids;Fmoc-Amino acid series | | Mol File: | 86060-90-4.mol |  |
| | FMOC-PRO-OPFP Chemical Properties |
| Melting point | 127-129 °C(lit.) | | Boiling point | 573.3±50.0 °C(Predicted) | | density | 1.455±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | -3.83±0.40(Predicted) | | form | Solid | | BRN | 4731096 | | Major Application | peptide synthesis | | InChIKey | CQBLOHXKGUNWRV-SFHVURJKSA-N | | SMILES | Fc1c(c(c(c(c1F)F)OC(=O)[C@H]2N(CCC2)C(=O)OCC3c4c(cccc4)c5c3cccc5)F)F | | CAS DataBase Reference | 86060-90-4 |
| WGK Germany | 3 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Irrit. 2 |
| | FMOC-PRO-OPFP Usage And Synthesis |
| Chemical Properties | White powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-PRO-OPFP Preparation Products And Raw materials |
|