| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Fmoc-Tyr(tBu)-OPfp Basic information |
| Product Name: | Fmoc-Tyr(tBu)-OPfp | | Synonyms: | N-ALPHA-(9-FLUORENYLMETHYLOXYCARBONYL)-O-T-BUTYL-L-TYROSINE PENTAFLUORPHENYL ESTER;N-ALPHA-FMOC-O-T-BUTYL-L-TYROSINE PENTAFLUOROPHENYL ESTER;FMOC-L-TYR(TBU)-OPFP;FMOC-TYROSINE(TBU)-OPFP;FMOC-TYR(BUT)-OPFP;FMOC-O-TERT-BUTYL-L-TYROSINE PENTAFLUOROPHENYL ESTER;FMOC-O-T-BUTYL-L-TYROSINE PENTAFLUOROPHENYL ESTER;NALPHA-9-Fluorenylmethoxycarbonyl-O-tert-butyl-L-tyrosine pentafluorophenyl | | CAS: | 86060-93-7 | | MF: | C34H28F5NO5 | | MW: | 625.58 | | EINECS: | | | Product Categories: | Fmoc-Amino Acids and Derivatives;Fmoc-Amino acid series;Amino Acids | | Mol File: | 86060-93-7.mol |  |
| | Fmoc-Tyr(tBu)-OPfp Chemical Properties |
| Melting point | 61-64℃ | | Boiling point | 713.3±60.0 °C(Predicted) | | density | 1.334±0.06 g/cm3(Predicted) | | storage temp. | Store at -15°C to -25°C. | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 10.13±0.46(Predicted) | | form | Powder | | color | White | | BRN | 4223194 | | Major Application | peptide synthesis | | InChIKey | ADOSTZDWXCEVJP-VWLOTQADSA-N | | SMILES | CC(C)(C)Oc1ccc(C[C@H](NC(=O)OCC2c3ccccc3-c4ccccc24)C(=O)Oc5c(F)c(F)c(F)c(F)c5F)cc1 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Irrit. 2 |
| | Fmoc-Tyr(tBu)-OPfp Usage And Synthesis |
| Uses | peptide synthesis | | General Description | The product number for this product was previously 04-12-1519.
To obtain a certificate of analysis (CoA) of a lot that begins with the letter “A”, please select the option in the right hand menu “Request a COA for Lot#s starting with A”. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-Tyr(tBu)-OPfp Preparation Products And Raw materials |
|