|
|
| | inulicin Basic information |
| Product Name: | inulicin | | Synonyms: | (3aS)-3,3aα,4,5,8,8aα-Hexahydro-4α-hydroxy-6-(3-acetoxypropyl)-5α,7-dimethyl-3-methylene-2H-cyclohepta[b]furan-2-one;(3aS)-6-(3-Acetoxypropyl)-3,3aα,4,5,8,8aα-hexahydro-4α-hydroxy-5α,7-dimethyl-3-methylene-2H-cyclohepta[b]furan-2-one;(3aS,4S,7aR)-5-[(1S)-4-(Acetyloxy)-1-methylbutyl]-3a,4,7,7a-tetrahydro-4-hydroxy-6-methyl-3-methylene-2(3H)-benzofuranone;inulicin;6-(3-acetoxy-propyl)-4-hydroxy-5,7-dimethyl-3-methylene-3,3a,4,5,8,8a-hexahydro-cyclohepta[b]furan-2-one;1-O-Acetylbritannilactone (Inulicin);2(3H)-Benzofuranone,5-[(1S)-4-(acetyloxy)-1-methylbutyl]-3a,4,7,7a-tetrahydro-4-hydroxy-6-methyl-3-methylene-,(3aS,4S,7aR)-;Inulicin(1-O-acetyl Britannilactone) | | CAS: | 33627-41-7 | | MF: | C17H24O5 | | MW: | 308.37 | | EINECS: | | | Product Categories: | | | Mol File: | 33627-41-7.mol |  |
| | inulicin Chemical Properties |
| Melting point | 124.0-126.1 °C | | Boiling point | 481.7±45.0 °C(Predicted) | | density | 1.16 | | storage temp. | 4°C, protect from light | | solubility | DMSO: soluble | | form | A solid | | pka | 13.71±0.60(Predicted) | | color | White to off-white | | biological source | plant | | Major Application | metabolomics vitamins, nutraceuticals, and natural products | | InChI | InChI=1S/C17H24O5/c1-9(6-5-7-21-12(4)18)14-10(2)8-13-15(16(14)19)11(3)17(20)22-13/h9,13,15-16,19H,3,5-8H2,1-2,4H3/t9-,13+,15+,16+/m0/s1 | | InChIKey | QKUFZFLZBUSEHN-CZLJMHDISA-N | | SMILES | O1[C@]2([H])CC(C)=C([C@@H](C)CCCOC(C)=O)[C@@H](O)[C@]2([H])C(=C)C1=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | inulicin Usage And Synthesis |
| Uses | Inulicin is a natural product derived from plant source th at finds application in compound screening libraries, metabolomics, phytochemical, and pharmaceutical research. | | Biological Activity | Inulicin (1-O-Acetylbritannilactone) is an active compound isolated from Inula Britannica L. It inhibits VEGF-mediated activation of Src and FAK. It also inhibits LPS-induced PGE2 production and COX-2 expression, as well as NF-κB activation and translocation. | | in vivo | Administration of a single dose of Inulicin (1-O-Acetylbritannilactone; 12 mg/kg/day) remarkably suppresses growth of A549 xenografts in nude mice. In vivo microvessels formation and Src activation are also significantly inhibited in Inulicin-treated xenograft tumors. To investigate the potential activity of Inulicin in vivo, a nude mice xenograft model is applied. | | target | | | IC 50 | NF-κB; COX-2 |
| | inulicin Preparation Products And Raw materials |
|