- 28-Homobrassinolide
-
- $0.00 / 10G
-
2026-04-14
- CAS:74174-44-0
- Min. Order: 10G
- Purity: 98%min
- Supply Ability: 30KG/month
- Homobrassinolide
-
- $0.10 / 1KG
-
2025-12-24
- CAS:74174-44-0
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 1000Tons
- homobrassinolide
-
- $1.00 / 1g
-
2025-02-13
- CAS:74174-44-0
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 1000
|
| | Homobrassinolide Basic information |
| Product Name: | Homobrassinolide | | Synonyms: | 28-Homobrassinolide;brassinolide-ethyl;28-HOMO-BR;6H-Benz[c]indeno[5,4-e]oxepin-6-one, 1-[(1S,4S)-4-ethyl-2,3-dihydroxy-1,5-dimethylhexyl]hexadecahydro-8,9-dihydroxy-10a,12a-dimethyl-, (1R,3aS,3bS,6aS,8S,9R,10aR,10bS,12aS)-;HOMOBRASSINOLIDE;28-HOMO-BR 90%TC brassinolide Brassins Kayaminori plant hormone growth regulator cas 74174-44-0 CAS NO.74174-44-0 CAS NO.74174-44-0;5α-CHOLESTANE-B-HOMO-7-OXA-24α-ETHYL-2α, 3α, 22α, 23α-TETROL-6-ONE;2α,3α,22R,23R-Tetradhydroxy-24S-Ethyl-B-Homo-7-Oxa-5α-Cholestan-6-One | | CAS: | 74174-44-0 | | MF: | C29H50O6 | | MW: | 494.7 | | EINECS: | | | Product Categories: | Bio-Pesticide;Miscellaneous Natural Products | | Mol File: | 74174-44-0.mol |  |
| | Homobrassinolide Chemical Properties |
| Boiling point | 643.0±55.0 °C(Predicted) | | density | 1.130±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | solubility | DMF: 1 mg/mL; DMSO: 5 mg/mL; Ethanol: Slightly soluble | | pka | 14.27±0.70(Predicted) | | form | A solid | | color | White to off-white | | InChIKey | YIWIWAWDXLBOKO-YHFMMDKCNA-N | | SMILES | O1[C@H](C(C)C(O)C(O)[C@@H](CC)C(C)C)C2[C@]3(C)C(CCC3)[C@@H](O)[C@@H](O)C2C2CC(=O)CC[C@]2([H])[C@@H]1C |&1:1,8,15,21,23,32,34,r| |
| | Homobrassinolide Usage And Synthesis |
| Uses | 28-Homobrassinolide being an analogue of brassinosteroids is improve the growth, yield and quality parameters in many crop plants. 28-Homobrassinolide 0.1% is recommended as foliar spray for most agricultural and horticultural crops such as :Grain crops such as Rice, and WheatVegetable crops such as Eggplant, Tomato, Bell pepper and Other Varieties such as Okra, Cabbage, and CauliflowerFiber crops such as CottonTuber crops such as PotatoOil seeds such as Peanut, Sunflower, and SoybeanPerennial flowering plants such as Jasmine, and RoseAnnual flowering plants such as MarigoldCash crops such as Banana, Sugarcane, Sugar beets, Tea, Coffee, and PepperFruit crops such as Grapes (Table and Wine), PomegranateNut crops such as Almonds and Walnuts 28-Homobrassinolide 0.1% is fully biodegradable, leaves no residues, and is environment friendly. | | Application | 28-Homobrassinolide is a derivative of Brassinolide (B677050), a plant hormone; natural steroid containing a seven-membered B-ring lactone, that promotes both cell elongation and cell devision. | | Definition | ChEBI: 28-Homobrassinolide is a brassinosteroid. | | benefits | 28-Homobrassinolide 0.1% contains a new generation plant growth promoter called ‘homobrassinolide’ as active ingredient, which is a natural substance with profound plant growth promoting activity.Homobrassinolide 0.1% enhances crop growth and development:Promoting cell division and cell elongationActing synergistically with other endogenous hormonesPromoting seed germination and increasing early vigor of seedlingsIncreasing photosynthesis and translocation of assimilates to economic plant partsIncreasing the levels of enzymes responsible for the synthesis of nucleic acids, proteins and sugarsImparting stress resistance under adverse environmental conditionsInducing flowering, and increasing fruit set and fruit growthIncreasing quality of produce. |
| | Homobrassinolide Preparation Products And Raw materials |
|