|
|
| | 2,5-Difluorobenzoic acid Basic information |
| Product Name: | 2,5-Difluorobenzoic acid | | Synonyms: | 2,5-DIFLUOROBENZOIC ACID;RARECHEM AL BO 0019;Benzoic acid, 2,5-difluoro-;2,5-Difluorobenzic acid;2-chloro-6-flurobenzyl cyanide;2,5-Difluorobenzoic;2,5-Difluorobenzoic acid 98%;2,5-Difluorobenzoicacid98% | | CAS: | 2991-28-8 | | MF: | C7H4F2O2 | | MW: | 158.1 | | EINECS: | 221-060-6 | | Product Categories: | Fluorine series;Indazoles;Organic Fluorinated Building Blocks;Other Fluorinated Organic Building Blocks;Aryl Fluorinated Building Blocks;Building Blocks;Carbonyl Compounds;Carboxylic Acids;Chemical Synthesis;Fluorinated Building Blocks;Organic Building Blocks;blocks;Carboxes;FluoroCompounds;Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;Fluorobenzene;Miscellaneous;Fluorobenzoic acids;C7;Carbonyl Compounds;Carboxylic Acids;Benzoic acid series;Fluorin-contained Benzoic acid series | | Mol File: | 2991-28-8.mol |  |
| | 2,5-Difluorobenzoic acid Chemical Properties |
| Melting point | 132-134 °C (lit.) | | Boiling point | 244.7±20.0 °C(Predicted) | | density | 1.3486 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | acetone: soluble25mg/mL, clear, faintly yellow | | pka | 2.93±0.10(Predicted) | | form | Solid | | color | White | | Water Solubility | Insoluble in water. | | BRN | 973351 | | InChI | InChI=1S/C7H4F2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11) | | InChIKey | LBQMIAVIGLLBGW-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(F)=CC=C1F | | CAS DataBase Reference | 2991-28-8(CAS DataBase Reference) | | NIST Chemistry Reference | 2,5-Difluorobenzoic acid(2991-28-8) | | EPA Substance Registry System | Benzoic acid, 2,5-difluoro- (2991-28-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,5-Difluorobenzoic acid Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | 2,5-Difluorobenzoic acid is used in the preparation of hydrazone derivatives, which acts as a potential antibacterial agent. | | Synthesis Reference(s) | Journal of Medicinal Chemistry, 28, p. 1864, 1985 DOI: 10.1021/jm00150a018 | | General Description | 2,5-Difluorobenzoic acid has been quantitated in ground water samples by liquid chromatography-tandem mass spectrometry. |
| | 2,5-Difluorobenzoic acid Preparation Products And Raw materials |
| Raw materials | 2,3,4,6-TETRAFLUOROBENZOIC ACID-->2',5'-Difluoroacetophenone-->1-Bromo-2,5-difluorobenzene-->Carbon dioxide-->1,2,4-Trifluorobenzene-->1,2,3,5-Tetrafluorobenzene-->1,4-Difluorobenzene | | Preparation Products | Solvent Violet 9-->3-Fluorobenzoic acid-->(2,5-Difluoro-phenyl)-carbaMic acid tert-butyl ester-->RARECHEM AL BI 0214 |
|