|
|
| | 1,3,5-Triaminobenzene trihydrochloride Basic information |
| Product Name: | 1,3,5-Triaminobenzene trihydrochloride | | Synonyms: | 1,3,5-TRIAMINOBENZENE TRICHLORIDE;1,3,5-triaMine trihydrochloride;1,3,5-BenzenetriaMine, trihydrochloride;1,3,5-triamineBenzene,hydrochloride(1:3);JACS-638-09-5;BENZENE-1,3,5-TRIAMINE 3HCL;Benzene-1,3,5-triaMine trihydrochloride;1,3,5-Triaminobenzene trihydrochloride | | CAS: | 638-09-5 | | MF: | C6H12Cl3N3 | | MW: | 232.54 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 1,3,5-Triaminobenzene trihydrochloride Chemical Properties |
| Melting point | 129 °C(Solv: chloroform (67-66-3)) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | White to light brown Solid | | InChI | InChI=1S/C6H9N3.3ClH/c7-4-1-5(8)3-6(9)2-4;;;/h1-3H,7-9H2;3*1H | | InChIKey | GSPBVFMIOSWQJB-UHFFFAOYSA-N | | SMILES | C1(N)=CC(=CC(N)=C1)N.Cl.Cl.Cl |
| | 1,3,5-Triaminobenzene trihydrochloride Usage And Synthesis |
| | 1,3,5-Triaminobenzene trihydrochloride Preparation Products And Raw materials |
|