|
|
| | 1,3,5-Benzenetricarboxaldehyde Basic information |
| Product Name: | 1,3,5-Benzenetricarboxaldehyde | | Synonyms: | 1,3,5-Benzenetricarboxaldehyde;benzene-1,3,5-tricarboxaldehyde;Benzene-1,3,5-tricarboxaldehyde 97%;6163-76-6;Trimesaldehyde;JACS-3163-76-6;Benzenetricarboxaldehyde;1,3,5-TriformyL | | CAS: | 3163-76-6 | | MF: | C9H6O3 | | MW: | 162.14 | | EINECS: | | | Product Categories: | | | Mol File: | 3163-76-6.mol |  |
| | 1,3,5-Benzenetricarboxaldehyde Chemical Properties |
| Melting point | 156-161°C | | Boiling point | 329.3±37.0 °C(Predicted) | | density | 1.303±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C9H6O3/c10-4-7-1-8(5-11)3-9(2-7)6-12/h1-6H | | InChIKey | AEKQNAANFVOBCU-UHFFFAOYSA-N | | SMILES | C1(C=O)=CC(C=O)=CC(C=O)=C1 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29122990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1,3,5-Benzenetricarboxaldehyde Usage And Synthesis |
| Chemical Properties | White crystals. Melting point 160-162°C. Easily soluble in hot water and alcohol, slightly soluble in water. | | Uses | Benzene-1,3,5-tricarboxaldehyde is extensively used in the synthesis of a wide range of porous organic cages and covalent organic frameworks. |
| | 1,3,5-Benzenetricarboxaldehyde Preparation Products And Raw materials |
|