|
|
| | (S)-2-(Z-amino)-4-phenylbutyric acid Basic information |
| Product Name: | (S)-2-(Z-amino)-4-phenylbutyric acid | | Synonyms: | CBZ-L-HOMOPHENYL-ALA;CBZ-(S)-2-AMINO-4-PHENYLBUTYRIC ACID;RARECHEM AL CF 0887;N-ALPHA-CARBOBENZOXY-L-HOMOPHENYLALANINE;N-ALPHA-CARBOBENZOXY-(+)-ALPHA-AMINO-4-PHENYLBUTYRIC ACID;Z-HOMOPHENYLALANINE;Z-HOPHE-OH;Z-HPH-OH | | CAS: | 127862-89-9 | | MF: | C18H19NO4 | | MW: | 313.35 | | EINECS: | | | Product Categories: | | | Mol File: | 127862-89-9.mol |  |
| | (S)-2-(Z-amino)-4-phenylbutyric acid Chemical Properties |
| Boiling point | 521.2±50.0 °C(Predicted) | | density | 1.222±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 3.93±0.10(Predicted) | | BRN | 3217335 | | Major Application | peptide synthesis | | InChI | 1S/C18H19NO4/c20-17(21)16(12-11-14-7-3-1-4-8-14)19-18(22)23-13-15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H,19,22)(H,20,21)/t16-/m0/s1 | | InChIKey | GUWSQYJXSRIJCI-INIZCTEOSA-N | | SMILES | OC(=O)[C@H](CCc1ccccc1)NC(=O)OCc2ccccc2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (S)-2-(Z-amino)-4-phenylbutyric acid Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | (S)-2-(Z-amino)-4-phenylbutyric acid Preparation Products And Raw materials |
|