- N-Benzylglycine
-
-
2025-04-04
- CAS:17136-36-6
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1Ton
- N-Benzylglycine
-
- $15.00
-
2021-08-11
- CAS:17136-36-6
- Min. Order: 1KG
- Purity: 99%+ HPLC
- N-Benzylglycine
-
- $100.00
-
2019-07-06
- CAS:17136-36-6
- Min. Order: 1KG
- Purity: 99%
|
| | N-Benzylglycine Basic information |
| | N-Benzylglycine Chemical Properties |
| Melting point | 232 °C (dec.)(lit.) | | Boiling point | 308.9±25.0 °C(Predicted) | | density | 1.161±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | form | Powder | | pka | 2.29±0.10(Predicted) | | color | White to off-white | | BRN | 2209788 | | InChI | InChI=1S/C9H11NO2/c11-9(12)7-10-6-8-4-2-1-3-5-8/h1-5,10H,6-7H2,(H,11,12) | | InChIKey | KGSVNOLLROCJQM-UHFFFAOYSA-N | | CAS DataBase Reference | 17136-36-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2922498590 |
| | N-Benzylglycine Usage And Synthesis |
| Uses | N-Benzylglycine is used as a replacement for aromatic amino acid residues in polypeptide analogues. This is done in order to determine the agonist or antagonist pharmacological properties of the analogue with respect to that specific amino acid. N-Benzylglycine is also used as a starting material to synthesize diazoketones. |
| | N-Benzylglycine Preparation Products And Raw materials |
|